| dbo:abstract
|
- Mibolerone, also known as dimethylnortestosterone (DMNT) and sold under the brand names Cheque Drops and Matenon, is a synthetic, orally active, and extremely potent anabolic–androgenic steroid (AAS) and a 17α-alkylated nandrolone (19-nortestosterone) derivative which was marketed by Upjohn for use as a veterinary drug. It was indicated specifically as an oral treatment for prevention of estrus (heat) in adult female dogs. (en)
|
| dbo:alternativeName
|
- Cheque Drops, Matenon (en)
|
| dbo:casNumber
| |
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 12184 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:h
| |
| dbp:image
|
- Mibolerone molecule ball.png (en)
|
| dbp:iupacName
| |
| dbp:iupharLigand
| |
| dbp:kegg
| |
| dbp:legalCa
| |
| dbp:legalUs
| |
| dbp:metabolism
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[C@@H]1CC2=CCCC[C@@H]2[C@@H]3[C@@H]1[C@@H]4CC[C@]O (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- PTQMMNYJKCSPET-OMHQDGTGSA-N (en)
|
| dbp:synonyms
|
- U-10997; CDB-904; Dimethylnandrolone; Dimethylnortestosterone; DMNT; 7α,17α-Dimethyl-19-nortestosterone; 7α,17α-Dimethylestr-4-en-17β-ol-3-one (en)
|
| dbp:tradename
|
- Cheque Drops, Matenon (en)
|
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:width
|
- 225 (xsd:integer)
- 235 (xsd:integer)
|
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Mibolerone, also known as dimethylnortestosterone (DMNT) and sold under the brand names Cheque Drops and Matenon, is a synthetic, orally active, and extremely potent anabolic–androgenic steroid (AAS) and a 17α-alkylated nandrolone (19-nortestosterone) derivative which was marketed by Upjohn for use as a veterinary drug. It was indicated specifically as an oral treatment for prevention of estrus (heat) in adult female dogs. (en)
|
| rdfs:label
| |
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageDisambiguates
of | |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
