Lihat sumber bagi Prolina

Anda tidak mempunyai keizinan untuk menyunting laman ini, atas sebab berikut:

Your IP address is in a range that has been blocked on all Wikimedia Foundation wikis.

Sekatan dilakukan oleh ‪Jon Kolbert‬. Alasannya ialah Open proxy/Webhost: See the help page if you are affected .

Tarikh bermula sekatan: 18:27, 12 November 2023
Tarikh tamat sekatan: 18:27, 12 November 2028

Alamat IP anda terkini ialah 54.147.35.254. The blocked range is 54.147.0.0/16.

Sila sertaian semua butiran di atas dalam sebarang pertanyaan yang anda buat. If you believe you were blocked by mistake, you can find additional information and instructions in the No open proxies global policy.

Otherwise, to discuss the block please post a request for review on Meta-Wiki. You could also send an email to the stewards VRT queue at stewards@wikimedia.org including all above details.

Anda boleh melihat dan menyalin sumber bagi laman ini.

{{Chembox
| ImageFileL2 = Prolin - Proline.svg
| ImageNameL2 = Formula struktur prolina
| ImageFileR2 = L-proline-skeletal.png
| ImageCaption = [[Formula rangka]] prolina
| ImageFileL3 = Proline-from-xtal-3D-bs-17-view-B.png
| ImageCaptionL3 = Model bola-dan-batang
| ImageFileR3 = Proline-from-xtal-3D-sf-view-B.png
| ImageCaptionR3 = Model ruangan
| IUPACName = Prolina
| SystematicName = Asid pirolidina-2-karboksilik<ref>{{cite web| url= https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=614&loc=ec_rcs |title=Proline| work = PubChem |publisher = U.S. National Library of Medicine |access-date=8 May 2018|url-status=live|archive-url=https://web.archive.org/web/20140116114913/http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=614&loc=ec_rcs|archive-date=16 January 2014}}</ref>
|Section1={{Chembox Identifiers
| index1_label = D/L
| index2_label = D
| index_label = L <!-- needs to be L (natural isomer) so drugbank etc. take correct index_label -->
| CASNo1 = 609-36-9
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo2 = 344-25-2
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo = 147-85-3
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem1 = 614
| PubChem2 = 8988
| PubChem = 145742
| ChemSpiderID1 = 594
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2 = 8640
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 128566
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII1 = DCS9E77JPQ
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = L01Q4LGZ5L
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9DLQ4CIU6V
| EINECS = 210-189-3
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00172
| KEGG = C00148
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Proline
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17203
| ChEBI1_Ref = {{ebicite|correct|EBI}}
| ChEBI1 = 26271
| ChEBI2_Ref = {{ebicite|correct|EBI}}
| ChEBI2 = 16313
| ChEMBL = 72275
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| RTECS = TW3584000
| Beilstein = 80812
| Gmelin = 26927
| SMILES = C1C[C@H](NC1)C(=O)O
| SMILES3 = [O-]C(=O)[C@H](CCC2)[NH2+]2
| SMILES3_Comment = L [[Zwiterion]]
| StdInChI = 1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ONIBWKKTOPOVIA-BYPYZUCNSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey1 = ONIBWKKTOPOVIA-UHFFFAOYSA-N
| InChIKey2 = ONIBWKKTOPOVIA-SCSAIBSYSA-N
}}
|Section2={{Chembox Properties
| C = 5
| H = 9
| N = 1
| O = 2
| Appearance = Hablur lutsinar
| MeltingPtC = 205 to 228
| MeltingPt_notes = (terurai)
| LogP = -0.06
| pKa=1.99 (karboksil), 10.96 (amino)<ref>{{cite book | vauthors = Nelson DL, Cox MM | title = Principles of Biochemistry | location = NY | publisher = W.H. Freeman and Company }}</ref>
| SolubleOther = 1.5g/100g ethanol 19 degC<ref>{{cite book |title=Food Chemistry | vauthors = Belitz HD, Grosch W, Schieberle P |isbn= 978-3-540-69933-0 |page=15 |url=https://books.google.com/books?id=xteiARU46SQC&q=proline&pg=PA15 |url-status=live |archive-url=https://web.archive.org/web/20160515000801/https://books.google.com/books?id=xteiARU46SQC&pg=PA15&lpg=PA15&dq=proline&redir_esc=y#v=onepage&q=proline&f=false |archive-date=2016-05-15 |date=2009-01-15 }}
</ref>
}}
|Section3={{Chembox Hazards
}}
}}

'''Prolina''' (''proline'', '''Pro''' atau '''P''')<ref>{{cite web| url = http://www.chem.qmul.ac.uk/iupac/AminoAcid/AA1n2.html | title = Nomenclature and Symbolism for Amino Acids and Peptides | publisher = IUPAC-IUB Joint Commission on Biochemical Nomenclature | year = 1983 | access-date = 5 March 2018| archive-url= https://web.archive.org/web/20081009023202/http://www.chem.qmul.ac.uk/iupac/AminoAcid/AA1n2.html| archive-date= 9 October 2008 | url-status= dead}}</ref> ialah sejenis [[asid amino]] yang digunakan dalam penghasilan [[protein]]. Struktur prolina adalah istimewa kerana tidak memiliki [[kumpulan amino]] {{chem|-NH|2}} seperti asid amino lazim, tetapi sebaliknya mempunyai [[amina sekunder]] (amina terikat kepada dua atom karbon). Nitrogen amino sekunder adalah dalam bentuk diprotonasi (NH<sub>2</sub><sup>+</sup>) dalam keadaan biologi, dengan [[kumpulan karboksil]] mengalami nyahprotonasi, −COO<sup>−</sup>. "Rantai sisi" dari [[Karbon alfa dan beta|karbon α]] bersambung dengan nitrogen sehingga membentuk gelung [[pirolidina]], menjadikannya sebagai asid amino alifatik. Proline tidak bersifat perlu, bermakna ia boleh dihasilkan sendiri oleh tubuh manusia, yakni daripda asid amino <small>L</small>-[[glutamat]].

== Rujukan ==
{{Reflist}}

== Pautan luar ==
* {{en}} [http://gmd.mpimp-golm.mpg.de/Spectrums/421929e5-2ddf-45bc-a7a3-533eeee502a6.aspx Proline MS Spectrum]
* {{en}} [http://www.biocarta.com/pathfiles/prolinePathway.asp Biosintesis prolina]

{{Asid amino}}
{{Neurotransmiter}}
{{Kawalan kewibawaan}}

[[Kategori:Asid amino proteinogenik]]
[[Kategori:Asid amino glukogenik]]
[[Kategori:Asid amino sekunder]]

Templat yang digunakan dalam laman ini:

Templat:Abbr (sunting)
Templat:Asid amino (sunting)
Templat:Bahasa pautan (sunting)
Templat:Border-radius (sunting)
Templat:Butang (sunting)
Templat:Button (sunting)
Templat:Cascite (sunting)
Templat:Chem (sunting)
Templat:Chem/atom (sunting)
Templat:Chem/link (sunting)
Templat:Chem molar mass (lihat sumber) (dilindungi separa)
Templat:Chem molar mass/format (lihat sumber) (dilindungi separa)
Templat:Chembox (sunting)
Templat:Chembox 3DMet (sunting)
Templat:Chembox 3DMet/format (sunting)
Templat:Chembox AllOtherNames (sunting)
Templat:Chembox AllOtherNames/format (sunting)
Templat:Chembox Appearance (sunting)
Templat:Chembox Beilstein (sunting)
Templat:Chembox CASNo (sunting)
Templat:Chembox CASNo/format (sunting)
Templat:Chembox CalcTemperatures (sunting)
Templat:Chembox ChEBI (sunting)
Templat:Chembox ChEBI/format (sunting)
Templat:Chembox ChEMBL (sunting)
Templat:Chembox ChEMBL/format (sunting)
Templat:Chembox ChemSpiderID (sunting)
Templat:Chembox ChemSpiderID/format (sunting)
Templat:Chembox CompTox (sunting)
Templat:Chembox CompTox/format (sunting)
Templat:Chembox DrugBank (sunting)
Templat:Chembox DrugBank/format (sunting)
Templat:Chembox ECHA (sunting)
Templat:Chembox ECNumber (sunting)
Templat:Chembox ECNumber/format (sunting)
Templat:Chembox Elements (sunting)
Templat:Chembox Elements/molecular formula (lihat sumber) (dilindungi separa)
Templat:Chembox Footer (sunting)
Templat:Chembox Footer/tracking (sunting)
Templat:Chembox Gmelin (sunting)
Templat:Chembox Hazards (sunting)
Templat:Chembox IUPHAR ligand (sunting)
Templat:Chembox IUPHAR ligand/format (sunting)
Templat:Chembox Identifiers (sunting)
Templat:Chembox InChI (sunting)
Templat:Chembox InChI/format (sunting)
Templat:Chembox Indexlist (sunting)
Templat:Chembox Jmol (sunting)
Templat:Chembox Jmol/format (sunting)
Templat:Chembox KEGG (sunting)
Templat:Chembox KEGG/format (sunting)
Templat:Chembox LogP (sunting)
Templat:Chembox MeSHName (sunting)
Templat:Chembox MeltingPt (sunting)
Templat:Chembox Properties (sunting)
Templat:Chembox PubChem (sunting)
Templat:Chembox PubChem/format (sunting)
Templat:Chembox RTECS (sunting)
Templat:Chembox RTECS/format (sunting)
Templat:Chembox SMILES (sunting)
Templat:Chembox SMILES/format (sunting)
Templat:Chembox Solubility (sunting)
Templat:Chembox UNII (sunting)
Templat:Chembox UNII/format (sunting)
Templat:Chembox headerbar (sunting)
Templat:Chembox image (sunting)
Templat:Chembox image sbs (sunting)
Templat:Chembox image sbs cell (sunting)
Templat:Chembox pKa (sunting)
Templat:Chembox templatePar/formatPreviewMessage (sunting)
Templat:Chemspidercite (sunting)
Templat:Cite book (lihat sumber) (dilindungi separa)
Templat:Cite web (lihat sumber) (dilindungi separa)
Templat:Collapsible list (lihat sumber) (dilindungi separa)
Templat:Convert (lihat sumber) (dilindungi)
Templat:Drugbankcite (sunting)
Templat:Ebicite (sunting)
Templat:EditAtWikidata (sunting)
Templat:En (sunting)
Templat:Fdacite (sunting)
Templat:First nonempty (sunting)
Templat:If empty (sunting)
Templat:Ikon bahasa (lihat sumber) (dilindungi)
Templat:Ikon en (lihat sumber) (dilindungi separa)
Templat:Kalau kosong (sunting)
Templat:Kawalan kewibawaan (sunting)
Templat:Keggcite (sunting)
Templat:Linear-gradient (sunting)
Templat:Longitem (sunting)
Templat:Main other (sunting)
Templat:Nama ISO 639 (sunting)
Templat:Navbox (lihat sumber) (dilindungi)
Templat:Navbox subgroup (sunting)
Templat:Neurotransmiter (sunting)
Templat:ParmPart (sunting)
Templat:Reflist (sunting)
Templat:Reflist/styles.css (sunting)
Templat:Senarai boleh lipat (lihat sumber) (dilindungi separa)
Templat:Stdinchicite (sunting)
Templat:Sunting di Wikidata (sunting)
Templat:Tick (sunting)
Templat:Unbulleted list (lihat sumber) (dilindungi separa)
Templat:Yesno (sunting)
Modul:Arguments (sunting)
Modul:Authority control (lihat sumber) (dilindungi separa)
Modul:Check for unknown parameters (sunting)
Modul:Citation/CS1 (lihat sumber) (dilindungi)
Modul:Citation/CS1/COinS (lihat sumber) (dilindungi)
Modul:Citation/CS1/Configuration (lihat sumber) (dilindungi)
Modul:Citation/CS1/Date validation (lihat sumber) (dilindungi)
Modul:Citation/CS1/Identifiers (lihat sumber) (dilindungi)
Modul:Citation/CS1/Utilities (lihat sumber) (dilindungi)
Modul:Citation/CS1/Whitelist (lihat sumber) (dilindungi)
Modul:Citation/CS1/styles.css (sunting)
Modul:Collapsible list (sunting)
Modul:Convert (sunting)
Modul:Convert/data (sunting)
Modul:Convert/text (sunting)
Modul:EditAtWikidata (sunting)
Modul:If empty (sunting)
Modul:InfoboxImage (sunting)
Modul:Math (sunting)
Modul:Navbar (lihat sumber) (dilindungi)
Modul:Navbar/configuration (sunting)
Modul:Navbar/styles.css (sunting)
Modul:Navbox (sunting)
Modul:No globals (sunting)
Modul:ResolveEntityId (sunting)
Modul:String (sunting)
Modul:TemplatePar (sunting)
Modul:Wikidata (sunting)
Modul:Wikidata/i18n (sunting)

Kembali ke Prolina.

Diambil daripada "https://ms.wikipedia.org/wiki/Prolina"