Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Solasodine: Difference between pages

(Difference between pages)
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 473997148 of page Solasodine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'KEGG', 'CASNo').
 
Using more neutral language
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Solasodine|oldid=473997148}} 473997148] of page [[Solasodine]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 429737371
| verifiedrevid =
| ImageFile = Solasodine.svg
| ImageFile = Solasodine.svg
⚫
| IUPACName = (,25''R'')-Spirosol--en--ol
| ImageSize = 200px
| SystematicName = (2''S'',2′''R'',4a''R'',4b''S'',5′''R'',6a''S'',6b''R'',7''S'',9a''S'',10a''S'',10b''S'')-4a,5′,6a,7-Tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiro[naptho[2′,1′:4,5]indeno[2,1-''b'']furan-8,2′-piperidin]-2-ol
⚫
| IUPACName = (3β,22α,25''R'')-Spirosol-5-en-3-ol
| OtherNames = Purapuridine; Solancarpidine; Solanearpidine; Solanidine-S
| OtherNames = Purapuridine; Solancarpidine; Solanearpidine; Solanidine-S
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| Abbreviations =
| Abbreviations =
| CASNo = <!-- blanked - oldvalue: 126-17-0 -->
| CASNo = 126-17-0
| CASNo_Ref = {{cascite|changed|??}}
| CASNo_Ref = {{cascite||}}
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| EINECS = 204-774-2
| PubChem = 442985
| =
⚫
| EINECS = 204-774-2
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 442985
⚫
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 391288
| ChemSpiderID = 391288
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 518252
| ChEMBL =
| SMILES = O[C@@H]6C/C5=C/C[C@@H]1[C@H](CC[C@]3([C@H]1C[C@@H]4O[C@@]2(NC[C@H](C)CC2)[C@H]([C@H]34)C)C)[C@@]5(C)CC6
| SMILES = O[C@@H]6C/C5=C/C[C@@H]1[C@H](CC[C@]3([C@H]1C[C@@H]4O[C@@]2(NC[C@H](C)CC2)[C@H]([C@H]34)C)C)[C@@]5(C)CC6
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1
| StdInChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KWVISVAMQJWJSZ-VKROHFNGSA-N
| StdInChIKey = KWVISVAMQJWJSZ-VKROHFNGSA-N
| RTECS =
| RTECS =
| MeSHName =
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI_Ref = {{ebicite||EBI}}
| ChEBI = 9190
| ChEBI = <!-- blanked - oldvalue: CHEBI:565242 -->
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite||kegg}}
| KEGG = <!-- blanked - oldvalue: C10822 -->
| KEGG = C10822
⚫
}}
| ATCCode_prefix =
|Section2={{Chembox Properties
| ATCCode_suffix =
⚫
| C=27|H=43|N=1|O=2
| ATC_Supplemental =
| Appearance =
⚫
| =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
⚫
| =
⚫
| =
⚫
| =
}}
}}
| Section2 = {{Chembox Properties
|={{Chembox
| ExternalSDS =
⚫
| C=27|H=43|N=1|O=2
| Appearance =
| =
| Density =
| =
| MeltingPt =
| =
| Melting_notes =
| =
| BoilingPt =
| =
| Boiling_notes =
| =
| Solubility =
| =
| SolubleOther =
| =
| Solvent =
| =
| pKa =
| =
| pKb =
| =
| PEL =
⚫
}}

| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards =
⚫
| NFPA-H =
⚫
| NFPA-F =
⚫
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
⚫
| PEL =
}}
}}
}}
}}

'''Solasodine''' is a [[poisonous]] [[alkaloid]] [[chemical compound]] that occurs in plants of the family [[Solanaceae]] such as potatoes and tomatoes.<ref name=Everist>{{cite book |last=Everist |first=S.L. |title=Poisonous Plants of Australia |publisher=Angus & Robertson |year=1981 |isbn=978-0-207-14228-4}}</ref> [[Solasonine]] and [[solamargine]] are [[glycoalkaloid]] derivatives of solasodine.<ref name=Everist/> Solasodine is [[teratogenic]] to hamster fetuses in a dose of 1200 to 1600&nbsp;mg/kg.<ref>{{cite book |last=Kinghorn |first=A.D. |chapter=Toxins and Teratogens of the Solanaceae and Liliaceae |title=Toxic plants |publisher=Society for Economic Botany, Columbia University Press |year=2010 |pages=75–76 |isbn=978-0231515689 |chapter-url=https://books.google.com/books?id=CZPDzu2dGDEC&pg=PA75}}</ref>
A 2013 literature survey found that various studies have indicated that solasodine may have diuretic, anticancer, antifungal, cardiotonic, antispermatogenetic, antiandrogenic, immunomodulatory, antipyretic and/or various other effects on central nervous system.<ref>{{cite journal |title=Medicinal significance, pharmacological activities, and analytical aspects of solasodine: A concise report of current scientific literature |first=Kanika |last=Patel |first2=Ravi B.|last2=Singh |first3=Dinesh K.|last3=Patel |journal=Journal of Acute Disease |volume=2 |issue=2 |year=2013 |pages=92–98 |doi=10.1016/S2221-6189(13)60106-7 |doi-access=free }}</ref>

== Uses ==
It is commercially used as a precursor for the production of complex [[steroidal]] compounds such as [[contraceptive pill]]s, via a [[16-DPA]] intermediate.<ref name=Everist/>

== See also ==
* ''[[Solanum mauritianum]]''

== References ==
{{reflist}}

[[Category:Steroidal alkaloids]]
[[Category:Plant toxins]]
[[Category:Steroidal alkaloids found in Solanaceae]]
[[Category:Spiro compounds]]


{{alkaloid-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"