Jump to content

Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Lithium bis(trifluoromethanesulfonyl)imide: Difference between pages

(Difference between pages)
Content deleted Content added
VisualWikitext
Saving copy of the {{chembox}} taken from revid 476752885 of page Titanium_dioxide for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG').
 
+image
 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Titanium_dioxide|oldid=476752885}} 476752885] of page [[Titanium_dioxide]] with values updated to verified values.}}
{{chembox
{{chembox
| Verifiedfields = changed
|Verifiedfields=changed
|Watchedfields=changed
| verifiedrevid = 457287101
|verifiedrevid=
| Name = Titanium dioxide
|Name=Lithium bis(trifluoromethane{{SHY}}sulfonyl)imide
| ImageFile = Titanium(IV)_oxide.jpg
|ImageFile1=Lithium bis(trifluoromethanesulfonyl)imide.svg
| ImageSize = 200px
⚫
|ImageSize1=200px
| ImageName = Titanium(IV) oxide
|ImageFile2=LiTFSI chunk.jpg
| ImageFile1 = Rutile-unit-cell-3D-balls.png
|IUPACName=Lithium bis(trifluoromethylsulfonyl)azanide
⚫
| ImageSize1 = 200px
|OtherNames=LiTFSI
| ImageName1 = The unit cell of rutile
⚫
|Section1={{Chembox Identifiers
| IUPACName = Titanium dioxide<br />Titanium(IV) oxide
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
| OtherNames = Titania<br/>[[Rutile]]<br/>[[Anatase]]<br/>[[Brookite]]
| UNII = 9Y730392A5
⚫
| Section1 = {{Chembox Identifiers
| InChI = 1S/C2F6NO4S2.Li/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;+1
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| = -UHFFFAOYSA-N
| ChemSpiderID = 24256
| SMILES = [Li+].C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
⚫
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 15FIX9V2JP
| =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| = {{||}}
⚫
| PubChem =
| ChEMBL = <!-- blanked - oldvalue: 1201136 -->
| InChI = 1/2O.Ti/rO2Ti/c1-3-2
| InChIKey = GWEVSGVZZGPLCZ-TYTSCOISAW
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32234
| SMILES = O=[Ti]=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2O.Ti
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫
| StdInChIKey = GWEVSGVZZGPLCZ-UHFFFAOYSA-N
| CASNo = 13463-67-7
| CASNo_Ref = {{cascite|correct|CAS}}
⚫
| PubChem = 26042
| RTECS = XR2775000
| RTECS = XR2775000
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C13409 -->
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = {{chem|TiO|2}}
| Formula = {{chem||2}}
| MolarMass = 79.866 g/mol
| MolarMass = .g/mol
| Appearance = White solid
| Appearance = White solid
| Odor = odorless
| Density = 4.23 g/cm<sup>3</sup>
| Density = .g/cm<sup>3</sup>
| MeltingPt = 1843 °C
| BoilingPt = 2972 °C
| =
| Solubility = 80.65% (22 °C)<ref>{{cite journal | last=Gilbert | first=William J. R. | last2=Safarov | first2=Javid | last3=Minnick | first3=David L. | last4=Rocha | first4=M. Alejandra | last5=Hassel | first5=Egon P. | last6=Shiflett | first6=Mark B. | title=Density, Viscosity, and Vapor Pressure Measurements of Water + Lithium Bis(trifluoromethylsulfonyl)imide Solutions | journal=Journal of Chemical & Engineering Data | publisher=American Chemical Society (ACS) | volume=62 | issue=7 | date=2017-06-05 | issn=0021-9568 | doi=10.1021/acs.jced.7b00135 | pages=2056–2066}}</ref>
| Solubility =
| RefractIndex = 2.488 (anatase) <br> 2.583 (brookite) <br> 2.609 (rutile)
⚫
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf = −945&nbsp;kJ·mol<sup>−1</sup><ref name=b1>{{cite book| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed.| publisher = Houghton Mifflin Company| year = 2009| isbn = 061894690X|page=A23}}</ref>
| Entropy = 50&nbsp;J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
}}
}}
| Section7 = {{Chembox Hazards
|Section7={{Chembox Hazards
| ExternalSDS = [https://cdn.shopify.com/s/files/1/0823/0287/files/MSDS-litfsi.pdf]
| ExternalMSDS = [http://www.inchem.org/documents/icsc/icsc/eics0338.htm ICSC 0338]
⚫
}}
| EUClass = Not listed
⚫
|Section8={{Chembox Related
| NFPA-H = 1
⚫
| OtherAnions =
| NFPA-F = 0
| NFPA-R = 0
| NFPA-O =
| FlashPt = Non-flammable
}}
⚫
| Section8 = {{Chembox Related
| OtherCations = <br />
}}
| Section8 = {{Chembox Related
⚫
| OtherAnions =
| OtherCations = [[Zirconium dioxide]]<br/>[[Hafnium dioxide]]
| OtherFunctn = [[Titanium(II) oxide]]<br/>[[Titanium(III) oxide]]<br/>[[Titanium(III,IV) oxide]]
| Function = [[titanium]] [[oxide]]s
| OtherCpds = [[Titanic acid]]
}}
}}
}}
}}

'''Lithium bis(trifluoromethanesulfonyl)imide''', often simply referred to as '''LiTFSI''', is a [[hydrophilic]] salt with the chemical formula LiC<sub>2</sub>F<sub>6</sub>NO<sub>4</sub>S<sub>2</sub>.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/90076-65-6#section=Top|title=90076-65-6 {{!}} C2F6LiNO4S2 - PubChem|last=Pubchem|website=pubchem.ncbi.nlm.nih.gov|language=en|access-date=2017-03-11}}</ref> It is commonly used as Li-ion source in [[electrolytes]] for Li-ion batteries as a safer alternative to commonly used [[lithium hexafluorophosphate]].<ref>{{Cite journal|last1=Kalhoff|first1=Julian|last2=Bresser|first2=Dominic|last3=Bolloli|first3=Marco|last4=Alloin|first4=Fannie|last5=Sanchez|first5=Jean-Yves|last6=Passerini|first6=Stefano|date=2014-10-01|title=Enabling LiTFSI-based Electrolytes for Safer Lithium-Ion Batteries by Using Linear Fluorinated Carbonates as (Co)Solvent|journal=ChemSusChem|language=en|volume=7|issue=10|pages=2939–2946|doi=10.1002/cssc.201402502|pmid=25138922|issn=1864-564X}}</ref> It is made up of one Li cation and a [[bistriflimide]] anion.

Because of its very high solubility in water (> 21 [[Molality|m]]), LiTFSI has been used as lithium salt in water-in-salt electrolytes for [[Aqueous lithium-ion battery|aqueous lithium-ion batteries]].<ref>{{Cite journal|last1=Suo|first1=Liumin|last2=Borodin|first2=Oleg|last3=Gao|first3=Tao|last4=Olguin|first4=Marco|last5=Ho|first5=Janet|last6=Fan|first6=Xiulin|last7=Luo|first7=Chao|last8=Wang|first8=Chunsheng|last9=Xu|first9=Kang|date=2015-11-20|title="Water-in-salt" electrolyte enables high-voltage aqueous lithium-ion chemistries|journal=Science|language=en|volume=350|issue=6263|pages=938–943|doi=10.1126/science.aab1595|issn=0036-8075|pmid=26586759|s2cid=206637574}}</ref><ref>{{Cite journal|last1=Smith|first1=Leland|last2=Dunn|first2=Bruce|date=2015-11-20|title=Opening the window for aqueous electrolytes|journal=Science|language=en|volume=350|issue=2015|pages=918|doi=10.1126/science.aad5575|issn=0036-8075|pmid=26586752|s2cid=206643843}}</ref>

== References ==
{{Reflist}}

{{Lithium compounds}}

[[Category:Lithium salts]]
[[Category:Lithium-ion batteries]]
[[Category:Organolithium compounds]]
[[Category:Trifluoromethyl compounds]]

{{organic-compound-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"