Jump to content

EA-3148: Difference between revisions

Content deleted Content added
ZéroBot (talk | contribs)
m r2.7.1) (robot Adding: pl:EA-3148
 
(30 intermediate revisions by 21 users not shown)
Line 1: Line 1:
{{chembox
{{chembox
| Verifiedfields = changed
| verifiedrevid = 391702571
| Watchedfields = changed
| Name = EA-3148
| verifiedrevid =
| ImageFile = EA-3148.svg
| ImageName = EA-3148
| = EA-3148
| ImageFile = EA-3148.svg
| IUPACName = ''O''-cyclopentyl ''S''-(2-diethylaminoethyl) methylphosphonothiolate
| = EA-3148
| Section1 = {{Chembox Identifiers
| PIN = ''O''-Cyclopentyl ''S''-[2-(diethylamino)ethyl] methylphosphonothioate
| CASNo = 93240-66-5
|Section1={{Chembox Identifiers
| SMILES = CCN(CC)CCSP(C)(=O)OC1CCCC1
| CASNo_Ref = {{cascite|correct|??}}
| PubChem = 559673
| CASNo = 93240-66-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HCH2YKB5LV
| SMILES = CCN(CC)CCSP(C)(=O)OC1CCCC1
| PubChem = 559673
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 486530
| InChI = 1/C12H26NO2PS/c1-4-13(5-2)10-11-17-16(3,14)15-12-8-6-7-9-12/h12H,4-11H2,1-3H3
| InChIKey = PMVOUPZOZITGTQ-UHFFFAOYAC
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C12H26NO2PS/c1-4-13(5-2)10-11-17-16(3,14)15-12-8-6-7-9-12/h12H,4-11H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = PMVOUPZOZITGTQ-UHFFFAOYSA-N
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>12</sub>H<sub>26</sub>NO<sub>2</sub>PS
| Formula = C<sub>12</sub>H<sub>26</sub>NO<sub>2</sub>PS
| MolarMass = 279.378 g/mol
| MolarMass = 279.378 g/mol
| Density = 1.05 g/mL
| Density = 1.05 g/
| MeltingPt =
| MeltingPt =
| BoilingPt = 111.11 °C
| = 111.11
}}
| Section3 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards = Highly Toxic
| NFPA-H = 4
| NFPA-F = 1
| NFPA-R = 1
| FlashPt =
| RPhrases =
| SPhrases =
}}
}}
|Section3={{Chembox Hazards
| ExternalSDS =
| MainHazards = Toxic
| NFPA-H = 4
| NFPA-F = 1
| NFPA-R = 1
| FlashPt =
}}
}}
}}


{{Chemical agents sidebar |nerve}}
'''EA-3148''' ('''Substance 100A''') is a "V-series" [[nerve agent]] related to the better-known compounds [[VX (nerve agent)|VX]] and [[VR (nerve agent)|VR]].<ref>D Hank Ellison. Handbook of Chemical and Biological Warfare Agents (2nd) 2008. p28. ISBN 0849314348</ref> It was studied by both the US and Soviet chemical weapons programmes during the Cold War, and is notable as the only nerve agent specifically identified in public domain sources as having a higher absolute potency as an [[acetylcholinesterase]] inhibitor than VX (around 50% more potent by weight).<ref>[http://www.nap.edu/openbook.php?record_id=740&page=7 Possible Long-Term Health Effects of Short-Term Exposure to Chemical Agents, Volume 1 (1982). Commission on Life Sciences. The National Academies Press. pp7,22,29,E3.]</ref> However both the US and Soviet investigations of the compound concluded that despite its high potency, the physicochemical properties of the substance made it unsuitable for weaponisation, and further research was not conducted.<ref>Vil S Mirzayanov. State Secrets. An Insider's Chronicle of the Russian Chemical Weapons Program. (2009) pp127-128. ISBN 9781432725662</ref> The chemical structure of EA-3148 falls within the scope of compounds designated "Toxic chemicals" under [[List of Schedule 1 substances (CWC)|Schedule 1]] of the [[Chemical Weapons Convention]] and so it is illegal throughout the world under international law and may only be used for certain types of scientific and medical research.


'''EA-3148''' ('''Substance 100A''') is a "V-series" [[nerve agent]] related to the better-known compounds [[VX (nerve agent)|VX]] and [[VR (nerve agent)|VR]].<ref> Ellison. Handbook of Chemical and Biological Warfare Agents 2nd 2008 </ref> It was studied by both the US and Soviet chemical weapons programmes during the Cold War, and is notable as the only nerve agent specifically identified in public domain sources as having a higher absolute potency as an [[acetylcholinesterase]] inhibitor than VX (around 50% more potent by weight).<ref>http://www.nap.edu/openbook.php?record_id=740&page=7 Possible Long-Term Health Effects of Short-Term Exposure to Chemical Agents 1 1982 Commission on Life Sciences The National Academies Press ,22,29,E3.</ref> However both the US and Soviet investigations of the compound concluded that despite its high potency, the physicochemical properties of the substance made it unsuitable for weaponisation, and further research was not conducted.<ref> Mirzayanov. State Secrets. An Insider's Chronicle of the Russian Chemical Weapons Program 1

The chemical structure of EA-3148 falls within the scope of compounds designated "Toxic chemicals" under [[List of Schedule 1 substances (CWC)|Schedule 1]] of the [[Chemical Weapons Convention]] and so it is illegal throughout the world under [[international law]] and may only be used for certain types of scientific and medical research.

== Effects ==
A healthy American male soldier was given EA-3148, 1.15&nbsp;μg/kg i.v.. [[Red blood cell|Erythrocyte]] AChE values dropped precipitously to 22% of normal within 15 min of dosing and to 0% at 48 h; the value recovered to 88% of normal at 72 days post-exposure. Signs of toxicity were evident within 5-8 min of treatment in two comparably dosed subjects who felt dizzy, weak, tired, sweaty, and had hands and feet that were moist. Within 2 h post-exposure, these subjects reportedly were resting, eating, and feeling fine.

A [[United States Army|U.S. Army]] report summarizing experience with EA-3148 noted anorexia, fatigue, poor sleep, unusual dreams, dizziness, euphoria, blurred vision, increased salivation, restlessness; decrements in a test of numerical facility in four individuals and exaggeration of a schizoid personality in one male soldier.<ref>Barry W. Wilson, Ph.D.. Low-Level Sarion Neurotoxicity and its Modulation by Pyridostigmine. University of California Davis, California.</ref>


==References==
==References==
{{reflist}}
<references/>


{{Chemical warfare}}
{{Chemical warfare}}
{{Acetylcholine metabolism and transport modulators}}
{{Cholinergics}}


[[Category:Anticholinesterases]]
[[Category:]]
[[Category:Nerve agents]]
[[Category: agents]]
[[Category:Phosphonothioates]]
[[Category:Phosphonothioates]]
[[Category:Chemical weapons]]
[[Category:Chemical weapons]]
[[Category:Cyclopentanes]]

[[Category:Diethylamino compounds]]
[[el:EA-3148]]
[[pl:EA-3148]]