Jump to content

Diisoheptyl phthalate: Difference between revisions

Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
Amirobot (talk | contribs)
56,602 edits
more ids and hazard upgrade
 
(16 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{Chembox
{{Chembox
| Verifiedfields = changed
⚫
| verifiedrevid = 307738793
| Watchedfields = changed
⚫
| verifiedrevid =
|Reference=<ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=en&N4=376671|ALDRICH&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Diisoheptyl phthalate] at [[Sigma-Aldrich]]</ref>
|Reference=<ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=en&N4=376671|ALDRICH&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Diisoheptyl phthalate] at [[Sigma-Aldrich]]</ref>
|ImageFile=diisoheptyl phthalate.png
|ImageFile=diisoheptyl phthalate.png
|ImageSize=180px
|ImageSize=180px
| ImageFile1 = Diisoheptyl phthalate 3D.png
|IUPACName=
| PIN = Bis(5-methylhexyl) benzene-1,2-dicarboxylate
|OtherNames= 1,2-benzenedicarboxylic acid, bis(isoheptyl) ester
|OtherNames= 1,2- acid bis(isoheptyl) ester
|Section1= {{Chembox Identifiers
|Section1= {{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=41451-28-9
| CASNo=41451-28-9
| CASOther= <br>[71888-89-6] (C6-C8 esters)
| ChEMBL = 1893293
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID =
| ChemSpiderID =
| EC_number = 276-158-1
| SMILES=variable
| MeSHName=
| MeSHName=
| PubChem = 591200
⚫
}}
| UNII = 9JJP9B98FG
| UNII_Ref = {{fdacite|correct|FDA}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H34O4/c1-17(2)11-7-9-15-25-21(23)19-13-5-6-14-20(19)22(24)26-16-10-8-12-18(3)4/h5-6,13-14,17-18H,7-12,15-16H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = RKELNIPLHQEBJO-UHFFFAOYSA-N
| SMILES = O=C(OCCCCC(C)C)C1=CC=CC=C1C(OCCCCC(C)C)=O
⚫
}}
|Section2= {{Chembox Properties
|Section2= {{Chembox Properties
| Formula=C<sub>22</sub>H<sub>34</sub>O<sub>4</sub>
| C22H34O4
| MolarMass =362.50 g/mol
| Appearance=
| Appearance=
| Density= 0.99 g/cm<sup>3</sup>
| Density= 0.99 g/cm<sup>3</sup>
Line 23: Line 34:
}}
}}
|Section3= {{Chembox Hazards
|Section3= {{Chembox Hazards
| FlashPt=113 °C
| =
| RPhrases = {{R62}} {{R63}}
| = {{}}
| GHSSignalWord = Warning
| SPhrases = {{S23}} {{S36/37}}
| HPhrases = {{H-phrases|360D}}

| PPhrases = {{P-phrases|201|202|281|308+313|405|501}}
}}
}}
}}
}}


'''Diisoheptyl phthalate''' is a [[phthalate]] used as a [[plasticizer]].<ref>[http://www.exxonmobilchemical.com/Public_Files/Oxo/Plasticizers/NorthAmerica/Jayflex_77_salesspec.pdf Jayflex 77 Product Sheet]</ref> Diisoheptyl phthalate is typically a mixture of chemical compounds consisting of various [[isoheptyl]] esters of [[phthalic acid]] with the [[chemical formula]] C<sub>22</sub>H<sub>34</sub>O<sub>4</sub>.
'''Diisoheptyl phthalate''' is a [[phthalate]] used as a [[plasticizer]].<ref>http://www.exxonmobilchemical.com/Public_Files/Oxo/Plasticizers/NorthAmerica/Jayflex_77_salesspec.pdf Jayflex 77 Product Sheet</ref> Diisoheptyl phthalate is typically a mixture of chemical compounds consisting of various [[isoheptyl]] esters of [[phthalic acid]] with the [[chemical formula]] C<sub>22</sub>H<sub>34</sub>O<sub>4</sub>.


==See also==
==See also==
Line 38: Line 50:
{{reflist}}
{{reflist}}


{{HealthIssuesOfPlastics}}


{{ester-stub}}
{{ester-stub}}


[[Category:Phthalates]]
[[Category:]]

[[ar:ثنائي أيزو هبتيل فثالات]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"