Ibodutant
{{Drugbox | IUPAC_name = Nα-[(1-{[(6-methyl-1-benzothien-2-yl)carbonyl]amino}cyclopentyl)carbonyl]-N-{[1-(tetrahydro-2H-pyran-4-ylmethyl)piperidin-4-yl]methyl}-D-phenylalaninamide | synonyms = 6-methyl-'N-[1-[[(2R)-1-[[1-(oxan-4-ylmethyl)piperidin-4- yl]methylamino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide | image = Ibodutant_structure.svg | width = 150px | CAS_number = | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 11527495 | DrugBank = | chemical_formula = | C=37 | H=48 | N=4 | O=4 | S=1 | molecular_weight = 644.866 g/mol | smiles = CC1=CC2=C(C=C1)C=C(S2)C(=O)NC3(CCCC3)C(=O)NC(CC4=CC=CC=C4)C(=O)NCC5CCN(CC5)CC6CCOCC6 | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = oral }}
Ibodutant is a candidate drug against irritable bowel syndrome, developed by The Menarini Group. As of May 2008[update], it is undergoing a multicentre double blind dose finding study.
Method of action
Ibodutant selectively blocks the tachykinin receptor NK2. Blockage is practically complete in nanomolar concentrations.
References
- H. Spreitzer (May 26, 2008). "Neue Wirkstoffe - Ibodutant". Österreichische Apothekerzeitung (in German) (11/2008): 541.
{{cite journal}}: Check date values in:|date=(help) - S. Giuliani, M. Altamura, C. A. Maggi. "Ibodutant. Tachykinin NK2 receptor antagonist, Treatment of irritable bowel syndrome". Drugs of the Future. 33 (2): 111–115.
{{cite journal}}: CS1 maint: multiple names: authors list (link)
 | This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |